C22H31N5 — CID 111742967
N'-methyl-3-(1-methylpyrazol-4-yl)-N-[(1-phenylcyclopentyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742967) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is N'-methyl-3-(1-methylpyrazol-4-yl)-N-[(1-phenylcyclopentyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[(1-phenylcyclopentyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742967 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[(1-phenylcyclopentyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C22H31N5/c1-23-21(27-13-10-18(16-27)19-14-25-26(2)15-19)24-17-22(11-6-7-12-22)20-8-4-3-5-9-20/h3-5,8-9,14-15,18H,6-7,10-13,16-17H2,1-2H3,(H,23,24) |
| InChIKey | JSXSYUMMTDDBEJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|