C17H28F3N5O — CID 109378127
N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378127) has the molecular formula C17H28F3N5O and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378127 |
| Molecular Formula | C17H28F3N5O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)c1c(C)noc1C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H28F3N5O/c1-11(15-12(2)23-26-13(15)3)10-22-16(21-5)25-8-6-24(7-9-25)14(4)17(18,19)20/h11,14H,6-10H2,1-5H3,(H,21,22) |
| InChIKey | IRAIJAWNRNLXMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|