C19H28F5N5 — CID 109379228
N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379228) has the molecular formula C19H28F5N5 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379228 |
| Molecular Formula | C19H28F5N5 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1c(F)cccc1F)N(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H28F5N5/c1-13(19(22,23)24)28-8-10-29(11-9-28)18(25-2)26-12-16(27(3)4)17-14(20)6-5-7-15(17)21/h5-7,13,16H,8-12H2,1-4H3,(H,25,26) |
| InChIKey | WAZQPRJJXNYBPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|