C19H35F3IN5O — CID 109378375
N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 109378375) has the molecular formula C19H35F3IN5O and a molecular weight of 533.42 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109378375 |
| Molecular Formula | C19H35F3IN5O |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C1CCCCC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H34F3N5O.HI/c1-3-23-18(25-10-9-24-17(28)16-7-5-4-6-8-16)27-13-11-26(12-14-27)15(2)19(20,21)22;/h15-16H,3-14H2,1-2H3,(H,23,25)(H,24,28);1H |
| InChIKey | YVGGTEFZRDTRKH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|