C13H22F3N7 — CID 109378552
N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378552) has the molecular formula C13H22F3N7 and a molecular weight of 333.36 g/mol. Its IUPAC name is N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378552 |
| Molecular Formula | C13H22F3N7 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncnn1C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N7/c1-10(13(14,15)16)22-4-6-23(7-5-22)12(17-2)18-8-11-19-9-20-21(11)3/h9-10H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | GOKPJCRBFFBUBY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|