C14H30N2O2 — CID 109379615
1-(3-hydroxy-2,2,4-trimethylpentyl)-3-pentylurea (PubChem CID 109379615) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-pentylurea.
| Compound Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-pentylurea |
|---|---|
| PubChem CID | 109379615 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-pentylurea |
| SMILES | CCCCCNC(=O)NCC(C)(C)C(O)C(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-6-7-8-9-15-13(18)16-10-14(4,5)12(17)11(2)3/h11-12,17H,6-10H2,1-5H3,(H2,15,16,18) |
| InChIKey | ZUXBSVBYAFNYBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|