C12H14N2O3 — CID 109379880
2-[[5-(furan-2-ylmethylamino)-2-pyridinyl]oxy]ethanol (PubChem CID 109379880) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[[5-(furan-2-ylmethylamino)-2-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[5-(furan-2-ylmethylamino)-2-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 109379880 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[[5-(furan-2-ylmethylamino)-2-pyridinyl]oxy]ethanol |
| SMILES | OCCOc1ccc(NCc2ccco2)cn1 |
| InChI | InChI=1S/C12H14N2O3/c15-5-7-17-12-4-3-10(8-14-12)13-9-11-2-1-6-16-11/h1-4,6,8,13,15H,5,7,9H2 |
| InChIKey | ACRVFFCKXRXSEQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |