C15H20FNO3 — CID 109380204
(E)-3-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxy-2-methylbutyl)prop-2-enamide (PubChem CID 109380204) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (E)-3-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxy-2-methylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxy-2-methylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 109380204 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (E)-3-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxy-2-methylbutyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)CCO)ccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-11(7-8-18)10-17-15(19)6-4-12-3-5-13(16)14(9-12)20-2/h3-6,9,11,18H,7-8,10H2,1-2H3,(H,17,19)/b6-4+ |
| InChIKey | FLWLRDAKDHTVDO-GQCTYLIASA-N |
| XLogP | 1.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|