C13H16FNO3 — CID 84590042
(E)-3-(4-fluoro-3-methoxyphenyl)-N-(1-hydroxypropan-2-yl)prop-2-enamide (PubChem CID 84590042) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is (E)-3-(4-fluoro-3-methoxyphenyl)-N-(1-hydroxypropan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-fluoro-3-methoxyphenyl)-N-(1-hydroxypropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 84590042 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (E)-3-(4-fluoro-3-methoxyphenyl)-N-(1-hydroxypropan-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(C)CO)ccc1F |
| InChI | InChI=1S/C13H16FNO3/c1-9(8-16)15-13(17)6-4-10-3-5-11(14)12(7-10)18-2/h3-7,9,16H,8H2,1-2H3,(H,15,17)/b6-4+ |
| InChIKey | SQQCIBFZDJNSFR-GQCTYLIASA-N |
| XLogP | 1.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|