C20H26N2O3 — CID 109381074
N-(3-hydroxy-2,2,4-trimethylpentyl)-4-(1H-pyrrole-3-carbonyl)benzamide (PubChem CID 109381074) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-4-(1H-pyrrole-3-carbonyl)benzamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-4-(1H-pyrrole-3-carbonyl)benzamide |
|---|---|
| PubChem CID | 109381074 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-4-(1H-pyrrole-3-carbonyl)benzamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)c1ccc(C(=O)c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-13(2)18(24)20(3,4)12-22-19(25)15-7-5-14(6-8-15)17(23)16-9-10-21-11-16/h5-11,13,18,21,24H,12H2,1-4H3,(H,22,25) |
| InChIKey | BBAOFLWYCOMWLD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |