C14H12Cl2N2O3 — CID 1093832
[5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 1093832) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 1093832 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | [5-(2,4-dichlorophenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2Cl)on1)N1CCOCC1 |
| InChI | InChI=1S/C14H12Cl2N2O3/c15-9-1-2-10(11(16)7-9)13-8-12(17-21-13)14(19)18-3-5-20-6-4-18/h1-2,7-8H,3-6H2 |
| InChIKey | JQHSWMRGAUNNPC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |