C20H35IN4O — CID 109383433
2-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383433) has the molecular formula C20H35IN4O and a molecular weight of 474.43 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383433 |
| Molecular Formula | C20H35IN4O |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(C)cc1)N(C)C)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C20H34N4O.HI/c1-6-21-20(24(5)14-17-11-12-25-15-17)22-13-19(23(3)4)18-9-7-16(2)8-10-18;/h7-10,17,19H,6,11-15H2,1-5H3,(H,21,22);1H |
| InChIKey | ZNYRRQGTRRYYGJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|