C20H30N6O2 — CID 109383696
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109383696) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109383696 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(4-methoxyphenyl)methyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | COc1ccc(C/N=C(/NCc2nnc(C)n2C)N(C)CC2CCOC2)cc1 |
| InChI | InChI=1S/C20H30N6O2/c1-15-23-24-19(26(15)3)12-22-20(25(2)13-17-9-10-28-14-17)21-11-16-5-7-18(27-4)8-6-16/h5-8,17H,9-14H2,1-4H3,(H,21,22) |
| InChIKey | UZCXHYHEVKQGBU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|