C20H39N5O3 — CID 109384589
tert-butyl 4-[3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 109384589) has the molecular formula C20H39N5O3 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109384589 |
| Molecular Formula | C20H39N5O3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | tert-butyl 4-[3-[[N,N'-dimethyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | C/N=C(/NCCCN1CCN(C(=O)OC(C)(C)C)CC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C20H39N5O3/c1-20(2,3)28-19(26)25-12-10-24(11-13-25)9-6-8-22-18(21-4)23(5)15-17-7-14-27-16-17/h17H,6-16H2,1-5H3,(H,21,22) |
| InChIKey | MNULGQSHHKWDNK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|