C20H32N4O3S — CID 109385275
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 109385275) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 109385275 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)N1CCCCC1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C20H32N4O3S/c1-21-20(23(2)15-17-10-13-27-16-17)22-14-18-8-4-5-9-19(18)28(25,26)24-11-6-3-7-12-24/h4-5,8-9,17H,3,6-7,10-16H2,1-2H3,(H,21,22) |
| InChIKey | PFCXKWZUUAQPMQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|