C25H37IN4O3 — CID 109387122
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-phenoxypropyl)guanidine;hydroiodide (PubChem CID 109387122) has the molecular formula C25H37IN4O3 and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-phenoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-phenoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109387122 |
| Molecular Formula | C25H37IN4O3 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-phenoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOc1ccccc1)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C25H36N4O3.HI/c1-4-26-25(27-13-8-16-32-22-9-6-5-7-10-22)28-20-11-14-29(15-12-20)21-17-23(30-2)19-24(18-21)31-3;/h5-7,9-10,17-20H,4,8,11-16H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | NEQHLXADICCNKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|