C20H35IN4O2S — CID 109387274
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 109387274) has the molecular formula C20H35IN4O2S and a molecular weight of 522.50 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109387274 |
| Molecular Formula | C20H35IN4O2S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(3-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCSC)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C20H34N4O2S.HI/c1-5-21-20(22-9-6-12-27-4)23-16-7-10-24(11-8-16)17-13-18(25-2)15-19(14-17)26-3;/h13-16H,5-12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | AMVQUDZDPCGMGE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|