C24H43IN6O2 — CID 109387860
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 109387860) has the molecular formula C24H43IN6O2 and a molecular weight of 574.55 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109387860 |
| Molecular Formula | C24H43IN6O2 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCCN(C)CC1)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C24H42N6O2.HI/c1-25-24(26-9-5-11-29-12-6-10-28(2)15-16-29)27-20-7-13-30(14-8-20)21-17-22(31-3)19-23(18-21)32-4;/h17-20H,5-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | XUFQZWAWOKUVSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|