C12H18N2O4 — CID 109388581
N-[3-[1-hydroxypropan-2-yl(methyl)amino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 109388581) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[3-[1-hydroxypropan-2-yl(methyl)amino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-hydroxypropan-2-yl(methyl)amino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 109388581 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[3-[1-hydroxypropan-2-yl(methyl)amino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | CC(CO)N(C)C(=O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O4/c1-9(8-15)14(2)11(16)5-6-13-12(17)10-4-3-7-18-10/h3-4,7,9,15H,5-6,8H2,1-2H3,(H,13,17) |
| InChIKey | OWLBMZVMIICHQV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |