C17H29N3O2 — CID 109388887
1-[2-(dimethylamino)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea (PubChem CID 109388887) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[2-(dimethylamino)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea.
| Compound Name | 1-[2-(dimethylamino)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
|---|---|
| PubChem CID | 109388887 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[2-(dimethylamino)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)Nc1ccccc1N(C)C |
| InChI | InChI=1S/C17H29N3O2/c1-12(2)15(21)17(3,4)11-18-16(22)19-13-9-7-8-10-14(13)20(5)6/h7-10,12,15,21H,11H2,1-6H3,(H2,18,19,22) |
| InChIKey | AKKZXFACLBOEBS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |