C19H28N2O3 — CID 109389448
N-(3-hydroxy-2,2,4-trimethylpentyl)-2-(6-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide (PubChem CID 109389448) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-2-(6-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-2-(6-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 109389448 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-2-(6-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide |
| SMILES | Cc1ccc2c(c1)N(C(=O)C(=O)NCC(C)(C)C(O)C(C)C)CC2 |
| InChI | InChI=1S/C19H28N2O3/c1-12(2)16(22)19(4,5)11-20-17(23)18(24)21-9-8-14-7-6-13(3)10-15(14)21/h6-7,10,12,16,22H,8-9,11H2,1-5H3,(H,20,23) |
| InChIKey | QCZKDJQQYJCKLU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|