C23H33N7O — CID 109391084
3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-1-methylguanidine (PubChem CID 109391084) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-1-methylguanidine.
| Compound Name | 3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109391084 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)N(C)Cc1cc(C)n(-c2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C23H33N7O/c1-7-24-23(25-14-22-27-26-16-29(22)8-2)28(5)15-19-13-17(3)30(18(19)4)20-9-11-21(31-6)12-10-20/h9-13,16H,7-8,14-15H2,1-6H3,(H,24,25) |
| InChIKey | AWOAXUWRTUBLRM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|