C23H27N3O4S — CID 10939137
(E)-1-[3-(hydroxymethyl)piperazin-1-yl]-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-en-1-one (PubChem CID 10939137) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is (E)-1-[3-(hydroxymethyl)piperazin-1-yl]-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(hydroxymethyl)piperazin-1-yl]-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10939137 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (E)-1-[3-(hydroxymethyl)piperazin-1-yl]-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-en-1-one |
| SMILES | CC(C)c1ccccc1Sc1ccc(/C=C/C(=O)N2CCNC(CO)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N3O4S/c1-16(2)19-5-3-4-6-21(19)31-22-9-7-17(13-20(22)26(29)30)8-10-23(28)25-12-11-24-18(14-25)15-27/h3-10,13,16,18,24,27H,11-12,14-15H2,1-2H3/b10-8+ |
| InChIKey | UDMVPCPDQWLIDT-CSKARUKUSA-N |
| XLogP | 3.68 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|