C25H29N3O5S — CID 11081394
methyl 1-methyl-4-[(E)-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-2-carboxylate (PubChem CID 11081394) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is methyl 1-methyl-4-[(E)-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[(E)-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 11081394 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | methyl 1-methyl-4-[(E)-3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)/C=C/c2ccc(Sc3ccccc3C(C)C)c([N+](=O)[O-])c2)CCN1C |
| InChI | InChI=1S/C25H29N3O5S/c1-17(2)19-7-5-6-8-22(19)34-23-11-9-18(15-20(23)28(31)32)10-12-24(29)27-14-13-26(3)21(16-27)25(30)33-4/h5-12,15,17,21H,13-14,16H2,1-4H3/b12-10+ |
| InChIKey | VKDICKOLJZIYGR-ZRDIBKRKSA-N |
| XLogP | 4.20 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|