C19H39N5O3 — CID 109391666
tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate (PubChem CID 109391666) has the molecular formula C19H39N5O3 and a molecular weight of 385.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109391666 |
| Molecular Formula | C19H39N5O3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN/C(=N/CCN1CCOCC1)NCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39N5O3/c1-6-10-24(18(25)27-19(3,4)5)12-9-22-17(20-7-2)21-8-11-23-13-15-26-16-14-23/h6-16H2,1-5H3,(H2,20,21,22) |
| InChIKey | AKJKGLMIAOCAOM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|