C21H42N6O4 — CID 111885087
tert-butyl 4-[2-[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111885087) has the molecular formula C21H42N6O4 and a molecular weight of 442.61 g/mol. Its IUPAC name is tert-butyl 4-[2-[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111885087 |
| Molecular Formula | C21H42N6O4 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | tert-butyl 4-[2-[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCN1CCN(C(=O)OC(C)(C)C)CC1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H42N6O4/c1-8-22-17(23-9-10-25-18(28)30-20(2,3)4)24-11-12-26-13-15-27(16-14-26)19(29)31-21(5,6)7/h8-16H2,1-7H3,(H,25,28)(H2,22,23,24) |
| InChIKey | YTIHFKDURCDQCN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|