C17H32F3N5O2 — CID 109378750
tert-butyl N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]carbamate (PubChem CID 109378750) has the molecular formula C17H32F3N5O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 109378750 |
| Molecular Formula | C17H32F3N5O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H32F3N5O2/c1-6-21-14(22-7-8-23-15(26)27-16(3,4)5)25-11-9-24(10-12-25)13(2)17(18,19)20/h13H,6-12H2,1-5H3,(H,21,22)(H,23,26) |
| InChIKey | LICWOQPCKLXLBY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|