C14H25FN4O2 — CID 97324733
tert-butyl (8aR)-3-(3-fluoropropylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 97324733) has the molecular formula C14H25FN4O2 and a molecular weight of 300.38 g/mol. Its IUPAC name is tert-butyl (8aR)-3-(3-fluoropropylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl (8aR)-3-(3-fluoropropylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 97324733 |
| Molecular Formula | C14H25FN4O2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | tert-butyl (8aR)-3-(3-fluoropropylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(NCCCF)=NC[C@@H]2C1 |
| InChI | InChI=1S/C14H25FN4O2/c1-14(2,3)21-13(20)18-7-8-19-11(10-18)9-17-12(19)16-6-4-5-15/h11H,4-10H2,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | SYQJFHSAWOAXEP-LLVKDONJSA-N |
| XLogP | 1.23 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|