C14H26F2N4O2 — CID 75514079
tert-butyl N-[1-[N-(2,2-difluoroethyl)-N'-methylcarbamimidoyl]pyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 75514079) has the molecular formula C14H26F2N4O2 and a molecular weight of 320.38 g/mol. Its IUPAC name is tert-butyl N-[1-[N-(2,2-difluoroethyl)-N'-methylcarbamimidoyl]pyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[N-(2,2-difluoroethyl)-N'-methylcarbamimidoyl]pyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 75514079 |
| Molecular Formula | C14H26F2N4O2 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | tert-butyl N-[1-[N-(2,2-difluoroethyl)-N'-methylcarbamimidoyl]pyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | C/N=C(\NCC(F)F)N1CCC(N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H26F2N4O2/c1-14(2,3)22-13(21)19(5)10-6-7-20(9-10)12(17-4)18-8-11(15)16/h10-11H,6-9H2,1-5H3,(H,17,18) |
| InChIKey | BDEQIHGXIROTPL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|