C22H41N5O4 — CID 109392428
tert-butyl N-[2-[[N-methyl-C-[4-(morpholine-4-carbonyl)piperidin-1-yl]carbonimidoyl]amino]ethyl]-N-propylcarbamate (PubChem CID 109392428) has the molecular formula C22H41N5O4 and a molecular weight of 439.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-methyl-C-[4-(morpholine-4-carbonyl)piperidin-1-yl]carbonimidoyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-methyl-C-[4-(morpholine-4-carbonyl)piperidin-1-yl]carbonimidoyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109392428 |
| Molecular Formula | C22H41N5O4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | tert-butyl N-[2-[[N-methyl-C-[4-(morpholine-4-carbonyl)piperidin-1-yl]carbonimidoyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN/C(=N\C)N1CCC(C(=O)N2CCOCC2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41N5O4/c1-6-10-27(21(29)31-22(2,3)4)13-9-24-20(23-5)26-11-7-18(8-12-26)19(28)25-14-16-30-17-15-25/h18H,6-17H2,1-5H3,(H,23,24) |
| InChIKey | BFARSRLGVJPPGB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|