C16H26N4O4 — CID 46984062
butyl 2-morpholin-4-yl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate (PubChem CID 46984062) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is butyl 2-morpholin-4-yl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate.
| Compound Name | butyl 2-morpholin-4-yl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
|---|---|
| PubChem CID | 46984062 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | butyl 2-morpholin-4-yl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)N=C(N1CCOCC1)NC2=O |
| InChI | InChI=1S/C16H26N4O4/c1-2-3-10-24-15(22)20-6-4-16(5-7-20)13(21)17-14(18-16)19-8-11-23-12-9-19/h2-12H2,1H3,(H,17,18,21) |
| InChIKey | BLIRFXCEELEDEL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|