C16H26N6O4 — CID 78304625
1-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperidine-4-carboxamide (PubChem CID 78304625) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperidine-4-carboxamide.
| Compound Name | 1-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78304625 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 1-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperidine-4-carboxamide |
| SMILES | CCOCCN1C(N2CCC(C(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H26N6O4/c1-3-26-9-8-22-11-13(20(2)16(25)19-14(11)24)18-15(22)21-6-4-10(5-7-21)12(17)23/h10-11,13H,3-9H2,1-2H3,(H2,17,23)(H,19,24,25) |
| InChIKey | HXNZLIFDJZWWOV-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|