C14H25N6O3+ — CID 6936427
(4R,5R)-1,3,7-trimethyl-8-(2-morpholin-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione (PubChem CID 6936427) has the molecular formula C14H25N6O3+ and a molecular weight of 325.39 g/mol. Its IUPAC name is (4R,5R)-1,3,7-trimethyl-8-(2-morpholin-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione.
| Compound Name | (4R,5R)-1,3,7-trimethyl-8-(2-morpholin-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 6936427 |
| Molecular Formula | C14H25N6O3+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (4R,5R)-1,3,7-trimethyl-8-(2-morpholin-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](NC(NCCN3CCOCC3)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C14H24N6O3/c1-17-10-11(18(2)14(22)19(3)12(10)21)16-13(17)15-4-5-20-6-8-23-9-7-20/h10-11H,4-9H2,1-3H3,(H,15,16)/p+1/t10-,11-/m1/s1 |
| InChIKey | JQHQRRPEANZWAX-GHMZBOCLSA-O |
| XLogP | -2.27 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|