About methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate
methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate (PubChem CID 118471983) has the molecular formula C10H14N4O4
and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate |
| PubChem CID | 118471983 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate |
| SMILES | COC(=O)[C@H](C)N1C=NC2NC(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C10H14N4O4/c1-5(9(16)18-3)14-4-11-7-6(14)8(15)13(2)10(17)12-7/h4-7H,1-3H3,(H,12,17)/t5-,6?,7?/m0/s1 |
| InChIKey | PATLCXGYCNSXTP-VTSJMVTISA-N |
| XLogP | -1.23 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate?
The IUPAC name of methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate (CID 118471983) is methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate.
What is the SMILES notation for methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate?
The canonical SMILES for methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate is COC(=O)[C@H](C)N1C=NC2NC(=O)N(C)C(=O)C21.
What is the InChIKey of methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate?
The InChIKey is PATLCXGYCNSXTP-VTSJMVTISA-N. The full InChI is InChI=1S/C10H14N4O4/c1-5(9(16)18-3)14-4-11-7-6(14)8(15)13(2)10(17)12-7/h4-7H,1-3H3,(H,12,17)/t5-,6?,7?/m0/s1.
What are the key properties of methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate?
methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate has a molecular weight of 254.25 g/mol, XLogP of -1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(1-methyl-2,6-dioxo-4,5-dihydro-3H-purin-7-yl)propanoate is sourced from PubChem (CID 118471983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).