C14H26N6O3+2 — CID 6936430
(4R,5S)-1,3,7-trimethyl-8-(2-morpholin-4-ium-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione (PubChem CID 6936430) has the molecular formula C14H26N6O3+2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (4R,5S)-1,3,7-trimethyl-8-(2-morpholin-4-ium-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione.
| Compound Name | (4R,5S)-1,3,7-trimethyl-8-(2-morpholin-4-ium-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 6936430 |
| Molecular Formula | C14H26N6O3+2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (4R,5S)-1,3,7-trimethyl-8-(2-morpholin-4-ium-4-ylethylamino)-5,9-dihydro-4H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H](NC(NCC[NH+]3CCOCC3)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C14H24N6O3/c1-17-10-11(18(2)14(22)19(3)12(10)21)16-13(17)15-4-5-20-6-8-23-9-7-20/h10-11H,4-9H2,1-3H3,(H,15,16)/p+2/t10-,11+/m0/s1 |
| InChIKey | JQHQRRPEANZWAX-WDEREUQCSA-P |
| XLogP | -3.69 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|