C16H26N6O4 — CID 53237797
2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 53237797) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 53237797 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CN1C(=O)C2C(N=CN2CC(=O)NCCCN2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C16H26N6O4/c1-19-14-13(15(24)20(2)16(19)25)22(11-18-14)10-12(23)17-4-3-5-21-6-8-26-9-7-21/h11,13-14H,3-10H2,1-2H3,(H,17,23) |
| InChIKey | DQUXJKKFXDVAOE-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|