C16H26N6O4 — CID 142690130
N,N-diethyl-5-methoxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide (PubChem CID 142690130) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is N,N-diethyl-5-methoxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide.
| Compound Name | N,N-diethyl-5-methoxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142690130 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N,N-diethyl-5-methoxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
| SMILES | CCN(CC)C(=O)N1C(=O)NC(=O)C2(OC)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C16H26N6O4/c1-4-20(5-2)15(25)22-13-16(26-3,12(23)19-14(22)24)18-10-21(13)11-6-8-17-9-7-11/h10-11,13,17H,4-9H2,1-3H3,(H,19,23,24) |
| InChIKey | GIZAVPSIZACGQV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |