C13H20N6O4 — CID 142690184
N-ethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide (PubChem CID 142690184) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-ethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide.
| Compound Name | N-ethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142690184 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-ethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
| SMILES | CCNC(=O)N1C(=O)NC(=O)C2(O)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C13H20N6O4/c1-2-15-11(21)19-10-13(23,9(20)17-12(19)22)16-7-18(10)8-3-5-14-6-4-8/h7-8,10,14,23H,2-6H2,1H3,(H,15,21)(H,17,20,22) |
| InChIKey | YQXUPWFJUHGTLS-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |