C11H16BrN5O3 — CID 142690144
3-bromo-5-methoxy-9-piperidin-4-yl-4H-purine-2,6-dione (PubChem CID 142690144) has the molecular formula C11H16BrN5O3 and a molecular weight of 346.19 g/mol. Its IUPAC name is 3-bromo-5-methoxy-9-piperidin-4-yl-4H-purine-2,6-dione.
| Compound Name | 3-bromo-5-methoxy-9-piperidin-4-yl-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 142690144 |
| Molecular Formula | C11H16BrN5O3 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-bromo-5-methoxy-9-piperidin-4-yl-4H-purine-2,6-dione |
| SMILES | COC12N=CN(C3CCNCC3)C1N(Br)C(=O)NC2=O |
| InChI | InChI=1S/C11H16BrN5O3/c1-20-11-8(18)15-10(19)17(12)9(11)16(6-14-11)7-2-4-13-5-3-7/h6-7,9,13H,2-5H2,1H3,(H,15,18,19) |
| InChIKey | SDFNOFHQPZZXJU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|