C13H18BrN5O3 — CID 142689753
9-(8-azabicyclo[3.2.1]octan-3-yl)-3-bromo-5-methoxy-4H-purine-2,6-dione (PubChem CID 142689753) has the molecular formula C13H18BrN5O3 and a molecular weight of 372.22 g/mol. Its IUPAC name is 9-(8-azabicyclo[3.2.1]octan-3-yl)-3-bromo-5-methoxy-4H-purine-2,6-dione.
| Compound Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-3-bromo-5-methoxy-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 142689753 |
| Molecular Formula | C13H18BrN5O3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-3-bromo-5-methoxy-4H-purine-2,6-dione |
| SMILES | COC12N=CN(C3CC4CCC(C3)N4)C1N(Br)C(=O)NC2=O |
| InChI | InChI=1S/C13H18BrN5O3/c1-22-13-10(20)17-12(21)19(14)11(13)18(6-15-13)9-4-7-2-3-8(5-9)16-7/h6-9,11,16H,2-5H2,1H3,(H,17,20,21) |
| InChIKey | GBSRWKVDRVUETI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|