C15H17BrF3N5O4 — CID 142689778
3-bromo-5-methoxy-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-yl]-4H-purine-2,6-dione (PubChem CID 142689778) has the molecular formula C15H17BrF3N5O4 and a molecular weight of 468.23 g/mol. Its IUPAC name is 3-bromo-5-methoxy-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-yl]-4H-purine-2,6-dione.
| Compound Name | 3-bromo-5-methoxy-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-yl]-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 142689778 |
| Molecular Formula | C15H17BrF3N5O4 |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 3-bromo-5-methoxy-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-yl]-4H-purine-2,6-dione |
| SMILES | COC12N=CN(C3CC4CCC(C3)N4C(=O)C(F)(F)F)C1N(Br)C(=O)NC2=O |
| InChI | InChI=1S/C15H17BrF3N5O4/c1-28-14-10(25)21-13(27)24(16)11(14)22(6-20-14)9-4-7-2-3-8(5-9)23(7)12(26)15(17,18)19/h6-9,11H,2-5H2,1H3,(H,21,25,27) |
| InChIKey | MVIJSTKIOJKOQV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|