C13H15BrF3N5O4 — CID 142690175
3-bromo-5-methoxy-9-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]-4H-purine-2,6-dione (PubChem CID 142690175) has the molecular formula C13H15BrF3N5O4 and a molecular weight of 442.19 g/mol. Its IUPAC name is 3-bromo-5-methoxy-9-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]-4H-purine-2,6-dione.
| Compound Name | 3-bromo-5-methoxy-9-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 142690175 |
| Molecular Formula | C13H15BrF3N5O4 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 3-bromo-5-methoxy-9-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]-4H-purine-2,6-dione |
| SMILES | COC12N=CN(C3CCN(C(=O)C(F)(F)F)CC3)C1N(Br)C(=O)NC2=O |
| InChI | InChI=1S/C13H15BrF3N5O4/c1-26-12-8(23)19-11(25)22(14)9(12)21(6-18-12)7-2-4-20(5-3-7)10(24)13(15,16)17/h6-7,9H,2-5H2,1H3,(H,19,23,25) |
| InChIKey | BOXPWCBRFOEFSG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|