C16H24BrN5O5 — CID 142690156
tert-butyl 4-(3-bromo-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate (PubChem CID 142690156) has the molecular formula C16H24BrN5O5 and a molecular weight of 446.30 g/mol. Its IUPAC name is tert-butyl 4-(3-bromo-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromo-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142690156 |
| Molecular Formula | C16H24BrN5O5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | tert-butyl 4-(3-bromo-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate |
| SMILES | COC12N=CN(C3CCN(C(=O)OC(C)(C)C)CC3)C1N(Br)C(=O)NC2=O |
| InChI | InChI=1S/C16H24BrN5O5/c1-15(2,3)27-14(25)20-7-5-10(6-8-20)21-9-18-16(26-4)11(23)19-13(24)22(17)12(16)21/h9-10,12H,5-8H2,1-4H3,(H,19,23,24) |
| InChIKey | ODTDOTWWMPBLSE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|