C18H30N6O4 — CID 73327365
methyl 2-[4-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate (PubChem CID 73327365) has the molecular formula C18H30N6O4 and a molecular weight of 394.48 g/mol. Its IUPAC name is methyl 2-[4-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73327365 |
| Molecular Formula | C18H30N6O4 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | methyl 2-[4-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
| SMILES | CCCCCN1C(N2CCN(CC(=O)OC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H30N6O4/c1-4-5-6-7-24-14-15(21(2)18(27)20-16(14)26)19-17(24)23-10-8-22(9-11-23)12-13(25)28-3/h14-15H,4-12H2,1-3H3,(H,20,26,27) |
| InChIKey | NMKMBUNOHLVEBQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|