C17H24N6O5 — CID 142690137
tert-butyl 4-(3-cyano-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate (PubChem CID 142690137) has the molecular formula C17H24N6O5 and a molecular weight of 392.42 g/mol. Its IUPAC name is tert-butyl 4-(3-cyano-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-cyano-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142690137 |
| Molecular Formula | C17H24N6O5 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | tert-butyl 4-(3-cyano-5-methoxy-2,6-dioxo-4H-purin-9-yl)piperidine-1-carboxylate |
| SMILES | COC12N=CN(C3CCN(C(=O)OC(C)(C)C)CC3)C1N(C#N)C(=O)NC2=O |
| InChI | InChI=1S/C17H24N6O5/c1-16(2,3)28-15(26)21-7-5-11(6-8-21)23-10-19-17(27-4)12(24)20-14(25)22(9-18)13(17)23/h10-11,13H,5-8H2,1-4H3,(H,20,24,25) |
| InChIKey | YJUGXTODFMOUSR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|