C11H14N6O3 — CID 142690168
5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carbonitrile (PubChem CID 142690168) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carbonitrile.
| Compound Name | 5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carbonitrile |
|---|---|
| PubChem CID | 142690168 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carbonitrile |
| SMILES | N#CN1C(=O)NC(=O)C2(O)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C11H14N6O3/c12-5-16-9-11(20,8(18)15-10(16)19)14-6-17(9)7-1-3-13-4-2-7/h6-7,9,13,20H,1-4H2,(H,15,18,19) |
| InChIKey | NGQFFNOASSIDBJ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|