C15H24N6O4 — CID 142690157
N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide (PubChem CID 142690157) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide.
| Compound Name | N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142690157 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
| SMILES | CCN(CC)C(=O)N1C(=O)NC(=O)C2(O)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C15H24N6O4/c1-3-19(4-2)14(24)21-12-15(25,11(22)18-13(21)23)17-9-20(12)10-5-7-16-8-6-10/h9-10,12,16,25H,3-8H2,1-2H3,(H,18,22,23) |
| InChIKey | YZGUUDRSVPENBW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |