C16H28N6O2 — CID 74813963
7-hexyl-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 74813963) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 7-hexyl-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-hexyl-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74813963 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 7-hexyl-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCN1C(N2CCNCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H28N6O2/c1-3-4-5-6-9-22-12-13(20(2)16(24)19-14(12)23)18-15(22)21-10-7-17-8-11-21/h12-13,17H,3-11H2,1-2H3,(H,19,23,24) |
| InChIKey | NTPPYPRFMXRDLH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|