C14H27N9O3 — CID 136828275
(3S)-3-amino-N-(2-carbamoylimino-1-methyl-4-oxo-1,3-diazinan-5-yl)-6-(diaminomethylideneamino)-N-methylhexanamide (PubChem CID 136828275) has the molecular formula C14H27N9O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is (3S)-3-amino-N-(2-carbamoylimino-1-methyl-4-oxo-1,3-diazinan-5-yl)-6-(diaminomethylideneamino)-N-methylhexanamide.
| Compound Name | (3S)-3-amino-N-(2-carbamoylimino-1-methyl-4-oxo-1,3-diazinan-5-yl)-6-(diaminomethylideneamino)-N-methylhexanamide |
|---|---|
| PubChem CID | 136828275 |
| Molecular Formula | C14H27N9O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3S)-3-amino-N-(2-carbamoylimino-1-methyl-4-oxo-1,3-diazinan-5-yl)-6-(diaminomethylideneamino)-N-methylhexanamide |
| SMILES | CN1CC(N(C)C(=O)C[C@@H](N)CCCN=C(N)N)C(=O)NC1=NC(N)=O |
| InChI | InChI=1S/C14H27N9O3/c1-22-7-9(11(25)20-14(22)21-13(18)26)23(2)10(24)6-8(15)4-3-5-19-12(16)17/h8-9H,3-7,15H2,1-2H3,(H4,16,17,19)(H3,18,20,21,25,26)/t8-,9?/m0/s1 |
| InChIKey | BGBUHGLMONTEDD-IENPIDJESA-N |
| XLogP | -2.92 |
| TPSA | 198.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|