C12H19N5O2 — CID 78202431
3,7-dimethyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 78202431) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 3,7-dimethyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78202431 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3,7-dimethyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N1CCCCC1)N2C |
| InChI | InChI=1S/C12H19N5O2/c1-15-8-9(16(2)12(19)14-10(8)18)13-11(15)17-6-4-3-5-7-17/h8-9H,3-7H2,1-2H3,(H,14,18,19) |
| InChIKey | RLWIEEDWHHIALA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |